CymitQuimica logo

CAS 1428551-28-3

:

9-([1,1'-Biphenyl]-3-yl)-3-bromo-9H-carbazole

Description:
9-([1,1'-Biphenyl]-3-yl)-3-bromo-9H-carbazole, identified by its CAS number 1428551-28-3, is an organic compound characterized by its complex structure, which includes a carbazole core substituted with a bromine atom and a biphenyl group. This compound typically exhibits properties associated with both aromaticity and halogenation, contributing to its potential applications in organic electronics, such as in light-emitting diodes (LEDs) and organic photovoltaics. The presence of the bromine atom can enhance its reactivity and influence its electronic properties, while the biphenyl moiety may improve solubility and stability. Additionally, compounds of this nature often display interesting photophysical properties, making them suitable for various optoelectronic applications. The synthesis and characterization of such compounds are of significant interest in materials science, particularly in the development of new organic materials with tailored electronic and optical properties.
Formula:C24H16BrN
InChI:InChI=1S/C24H16BrN/c25-19-13-14-24-22(16-19)21-11-4-5-12-23(21)26(24)20-10-6-9-18(15-20)17-7-2-1-3-8-17/h1-16H
InChI key:NSRPRPVECXNOLB-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=CC(=CC=C2)N3C4=C(C=C(C=C4)Br)C5=CC=CC=C53
Found 5 products.