CAS 1428582-36-8

B-[3-(4-Methyl-1H-pyrazol-1-yl)phenyl]boronic acid

Description:

B-[3-(4-Methyl-1H-pyrazol-1-yl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a pyrazole moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications including organic synthesis and medicinal chemistry. The presence of the pyrazole group may impart specific biological activities, enhancing its potential as a pharmaceutical agent. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are vital in the formation of carbon-carbon bonds in organic synthesis. The compound's solubility, stability, and reactivity can vary based on the pH and the presence of other functional groups. Overall, B-[3-(4-Methyl-1H-pyrazol-1-yl)phenyl]boronic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₁₀H₁₁BN₂O₂

InChI: InChI=1S/C10H11BN2O2/c1-8-6-12-13(7-8)10-4-2-3-9(5-10)11(14)15/h2-7,14-15H,1H3

InChI key: InChIKey=ALUPGYPYXASNLN-UHFFFAOYSA-N

SMILES: B(O)(O)C=1C=C(C=CC1)N2N=CC(C)=C2

Synonyms:

• [3-(4-Methylpyrazol-1-yl)phenyl]boronic acid
• B-[3-(4-Methyl-1H-pyrazol-1-yl)phenyl]boronic acid
• Boronic acid, B-[3-(4-methyl-1H-pyrazol-1-yl)phenyl]-
• [3-(4-Methyl-1H-pyrazol-1-yl)phenyl]boronic acid

(3-(4-Methyl-1H-pyrazol-1-yl)phenyl)boronic acid

CAS: 1428582-36-8

Formula: C₁₀H₁₁BN₂O₂

Molecular weight: 202.0175

Ref: IN-DA01AOUJ

[3-(4-Methyl-1H-pyrazol-1-yl)phenyl]boronic acid

CAS: 1428582-36-8

Versatile small molecule scaffold

Formula: C₁₀H₁₁BN₂O₂

Purity: Min. 95%

Molecular weight: 202.02 g/mol

Ref: 3D-DHC58236