CAS 14287-21-9
:N-acetyl-phe-lys
Description:
N-acetyl-phe-lys, also known as N-acetylphenylalanylleucine, is a dipeptide derivative characterized by the presence of an acetyl group attached to the phenylalanine residue. This compound is typically synthesized through peptide coupling methods, which involve the formation of a bond between the carboxyl group of one amino acid and the amino group of another. N-acetyl-phe-lys exhibits properties common to peptides, such as solubility in polar solvents and potential bioactivity, which may include roles in biological signaling or as precursors in various biochemical pathways. The acetylation of the phenylalanine residue can influence the compound's stability, solubility, and interaction with biological targets. Additionally, the presence of lysine contributes to the overall charge and hydrophilicity of the molecule, which can affect its behavior in physiological environments. As with many peptides, N-acetyl-phe-lys may have applications in pharmaceuticals, research, and biochemistry, particularly in studies related to protein synthesis and enzymatic activity.
Formula:C17H25N3O4
InChI:InChI=1/C17H25N3O4/c1-12(21)19-15(11-13-7-3-2-4-8-13)16(22)20-14(17(23)24)9-5-6-10-18/h2-4,7-8,14-15H,5-6,9-11,18H2,1H3,(H,19,21)(H,20,22)(H,23,24)/t14-,15-/m0/s1
SMILES:CC(=N[C@@H](Cc1ccccc1)C(=N[C@@H](CCCCN)C(=O)O)O)O
Synonyms:- Ac-Phe-Lys-OH
- N-acetyl-L-phenylalanyl-L-lysine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ac-Phe-Lys-OH
CAS:Inverted aspartame-type sweetener. Adrover et al. used Ac-Phe-Lys as a model compound in their studies on protein glycation.Formula:C17H25N3O4Purity:> 99%Color and Shape:White PowderMolecular weight:335.4Ac-Phe-Lys-OH
CAS:Ac-Phe-Lys-OH is a synthetic peptide that mimics the lysine side chain of L-lysine. It has been shown to be cytotoxic to cancer cells and cardiac cells, with the formation rate of Ac-Phe-Lys-OH being dependent on the concentration of glycolaldehyde. The reaction yield for Ac-Phe-Lys-OH is also dependent on creatine kinase activity. Acetylation of Ac-Phe-Lys-OH reduces its cytotoxicity and increases its solubility in water.
Formula:C17H25N3O4Purity:Min. 95%Molecular weight:335.4 g/mol

