CAS 14287-99-1

N1,N1,N3,N3-Tetrakis(2-methylpropyl)propanediamide

Description:

N1,N1,N3,N3-Tetrakis(2-methylpropyl)propanediamide, with CAS number 14287-99-1, is an organic compound characterized by its amide functional groups and a branched alkyl chain. This substance features a propanediamide backbone, which is substituted with four 2-methylpropyl groups, contributing to its hydrophobic nature. The presence of multiple alkyl chains enhances its solubility in organic solvents while limiting its solubility in water. This compound is typically used in various applications, including as a ligand in coordination chemistry and in the synthesis of more complex organic molecules. Its structural characteristics may impart unique properties such as thermal stability and potential utility in polymer chemistry. Additionally, the branched alkyl groups can influence its physical properties, such as melting and boiling points, as well as its reactivity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₉H₃₈N₂O₂

InChI: InChI=1S/C19H38N2O2/c1-14(2)10-20(11-15(3)4)18(22)9-19(23)21(12-16(5)6)13-17(7)8/h14-17H,9-13H2,1-8H3

InChI key: InChIKey=ZABBKBCPKIMSFX-UHFFFAOYSA-N

SMILES: N(C(CC(N(CC(C)C)CC(C)C)=O)=O)(CC(C)C)CC(C)C

Synonyms:

• N1,N1,N3,N3-Tetrakis(2-methylpropyl)propanediamide
• Tetraisobutyl malonamide
• Malonamide, N,N,N′,N′-tetraisobutyl-
• Propanediamide, N1,N1,N3,N3-tetrakis(2-methylpropyl)-
• Propanediamide, N,N,N′,N′-tetrakis(2-methylpropyl)-

N,n,n,n-tetraisobutyl-malonamide

CAS: 14287-99-1

N,n,n,n-tetraisobutyl-malonamide

Purity: 95%

Molecular weight: 326.53g/mol

Ref: 54-OR1047510

N,N,N',N'-Tetrakis(2-methylpropyl)propanediamide

CAS: 14287-99-1

N,N,N',N'-Tetrakis(2-methylpropyl)propanediamide (TPDA) is a hexavalent diamide that has been used as a catalyst in organic synthesis. TPDA has shown to be an effective catalyst for the Diels-Alder reaction of 2,3-dimethylbutadiene with maleic anhydride. TPDA is also useful in the synthesis of polymers such as polyurethane and polyimides.

Formula: C₁₉H₃₈N₂O₂

Purity: Min. 95%

Molecular weight: 326.5 g/mol

Ref: 3D-PAA28799