CAS 142878-12-4
:U73343
Description:
U73343, with the CAS number 142878-12-4, is a chemical compound known for its role as a selective inhibitor of certain protein kinases, particularly those involved in signal transduction pathways. It is often utilized in biochemical research to study the effects of inhibiting specific kinases on cellular processes. U73343 is characterized by its ability to modulate various physiological responses, making it a valuable tool in pharmacological studies. The compound is typically presented as a solid and is soluble in organic solvents, which facilitates its use in laboratory settings. Its mechanism of action involves interference with the phosphorylation processes that are crucial for cell signaling, thereby influencing cellular functions such as proliferation, differentiation, and apoptosis. Researchers often explore its potential therapeutic applications, particularly in the context of diseases where kinase activity is dysregulated. As with many chemical substances, proper handling and safety precautions are essential when working with U73343 in a laboratory environment.
Formula:C29H42N2O3
InChI:InChI=1/C29H42N2O3/c1-29-16-15-23-22-10-8-21(34-2)19-20(22)7-9-24(23)25(29)11-12-26(29)30-17-5-3-4-6-18-31-27(32)13-14-28(31)33/h8,10,19,23-26,30H,3-7,9,11-18H2,1-2H3/t23-,24-,25+,26+,29+/m1/s1
Synonyms:- U-73343
- 1-(6-{[(17Beta)-3-Methoxyestra-1,3,5(10)-Trien-17-Yl]Amino}Hexyl)Pyrrolidine-2,5-Dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
U-73343
CAS:<p>U-73343 is an inactive analog of U-73122 and can be used as a negative control. U-73122 dose-dependently inhibits acid secretion irrespective of the stimulant.</p>Formula:C29H42N2O3Purity:99.06%Color and Shape:SolidMolecular weight:466.66U-73343
CAS:<p>U-73343 is a selective inhibitor of the ubiquitin ligase activity of the p2y receptor. The in vitro method and whole-cell recordings have been used to show that U-73343 inhibits signal pathways involved in energy metabolism. It also inhibits intracellular Ca2+ levels and phospholipase production, which are related to receptor activity. This drug has been shown to be an experimental model for the study of cytosolic Ca2+. The p2y receptor is a G-protein coupled receptor that binds adenosine diphosphate (ADP) and plays a role in many physiological processes, including vasodilation, platelet aggregation, cell proliferation, and immune response. Inhibition of the ubiquitin ligase activity of this receptor may provide a new target for drug development.</p>Formula:C29H42N2O3Purity:Min. 95%Molecular weight:466.66 g/mol




