CAS 142885-91-4
:4-Desmethoxy-4-nitro Omeprazole Sulfide
Description:
4-Desmethoxy-4-nitro Omeprazole Sulfide, with the CAS number 142885-91-4, is a chemical compound that is a derivative of the proton pump inhibitor omeprazole. This substance features a sulfinyl group, which contributes to its chemical reactivity and potential pharmacological properties. It is characterized by the presence of a nitro group and a desmethoxy modification, which alters its biological activity compared to its parent compound. The compound is typically studied for its potential effects on gastric acid secretion and its role in treating conditions like gastroesophageal reflux disease (GERD). In terms of solubility, it may exhibit varying degrees of solubility in organic solvents, which is common for many pharmaceutical compounds. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the presence of nitro and sulfinyl groups may pose specific hazards.
Formula:C16H16N4O3S
InChI:InChI=1/C16H16N4O3S/c1-9-7-17-14(10(2)15(9)20(21)22)8-24-16-18-12-5-4-11(23-3)6-13(12)19-16/h4-7H,8H2,1-3H3,(H,18,19)
SMILES:Cc1cnc(CSc2nc3ccc(cc3[nH]2)OC)c(C)c1N(=O)=O
Synonyms:- 5-Methoxy-2-{[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]thio}-1H-benzimidazol
- 2-[[(3,5-Dimethyl-4-nitro-2-pyridinyl)methyl]thio]-5-methoxy-1H-benzimidazole
- 5-Methoxy-2-[[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]thio]-1H-benzimidazole
- 2-{[(3,5-dimethyl-4-nitropyridin-2-yl)methyl]sulfanyl}-6-methoxy-1H-benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

