CAS 14289-34-0
:L,L-Diaminopimelic acid
Description:
L,L-Diaminopimelic acid (DAP) is a naturally occurring amino acid that plays a crucial role in the biosynthesis of peptidoglycan, a key component of bacterial cell walls. It is characterized by its two amino groups and a carboxylic acid group, which contribute to its basic properties and solubility in water. DAP exists in two stereoisomeric forms, with the L,L configuration being the biologically relevant form. This compound is particularly significant in the context of certain Gram-negative bacteria and some Gram-positive bacteria, where it serves as a precursor for lysine and is involved in the synthesis of various peptides. L,L-Diaminopimelic acid is also utilized in research and industrial applications, including the development of antibiotics and other pharmaceuticals. Its structural features allow it to participate in various biochemical pathways, making it an important molecule in microbiology and biochemistry. Additionally, its presence in bacterial cell walls makes it a target for antibiotic action, highlighting its relevance in the study of antimicrobial resistance.
Formula:C7H14N2O4
InChI:InChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m0/s1
InChI key:InChIKey=GMKMEZVLHJARHF-WHFBIAKZSA-N
SMILES:[C@@H](C(O)=O)(CCC[C@@H](C(O)=O)N)N
Synonyms:- (2S,6S)-2,6-diaminoheptanedioic acid
- (S,S)-Diaminopimelate
- (S-(R*,R*))-2,6-Diaminoheptanedioic acid
- <span class="text-smallcaps">L</smallcap>,<smallcap>L</span>-2,6-Diaminopimelic acid
- <span class="text-smallcaps">L</smallcap>,<smallcap>L</span>-Diaminopimelic acid
- <span class="text-smallcaps">L</smallcap>,<smallcap>L</span>-α,ε-diaminopimelic acid
- <span class="text-smallcaps">L</span>-2,6-Diaminopimelic acid
- <span class="text-smallcaps">L</span>-Diaminopimelate
- <span class="text-smallcaps">L</span>-Diaminopimelic acid
- <span class="text-smallcaps">L</span>-threo-2,6-Diaminopimelic acid
- <span class="text-smallcaps">L</span>-α,ε-Diaminopimelic acid
- Heptanedioic acid, 2,6-diamino-, (2S,6S)-
- Heptanedioic acid, 2,6-diamino-, (S-(R*,R*))-
- Nitrogen
- L-Diaminopimelic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(6S,2S)-Diaminopimelic acid
CAS:Formula:C7H14N2O4Purity:95.0%Color and Shape:SolidMolecular weight:190.19706(2S,6S)-2,6-diaminoheptanedioic acid
CAS:(2S,6S)-2,6-diaminoheptanedioic acidPurity:≥95%Molecular weight:190.20g/molLl-2,6-diaminopimelic acid
CAS:<p>Ll-2,6-diaminopimelic acid is a trifunctional amino acid that can be synthesized in the human body or taken as a dietary supplement. Ll-2,6-diaminopimelic acid is used to treat infectious diseases caused by bacteria and fungi. Ll-2,6-diaminopimelic acid inhibits protein synthesis by acting on the ribosome and blocking the formation of peptide bonds between amino acids. It also inhibits fatty acid synthesis and the production of hydroxyl radicals from hydrogen peroxide. Ll-2,6-diaminopimelic acid binds to toll-like receptors on the surface of certain cells and can activate them to produce antimicrobial agents such as cytokines and chemokines. Ll-2,6-diaminopimelic acid has been shown to inhibit the growth of Mycobacterium tuberculosis when incubated with human monocytic cell</p>Formula:C7H14N2O4Purity:Min. 95%Molecular weight:190.2 g/mol



