CAS 1429-30-7: Petunidin
Description:Petunidin is a naturally occurring anthocyanin, a type of flavonoid pigment responsible for the red, purple, and blue colors in many fruits, vegetables, and flowers. It is primarily found in plants such as petunias and various berries. The chemical structure of petunidin includes a 3,5-dihydroxy-4-methoxyphenyl group, contributing to its distinctive color properties and antioxidant activity. Petunidin is known for its stability under acidic conditions, which enhances its color intensity, making it a valuable compound in food and beverage industries as a natural colorant. Additionally, it exhibits potential health benefits, including anti-inflammatory and antioxidant effects, which have garnered interest in nutritional and pharmaceutical research. The compound is soluble in water and alcohol, facilitating its extraction from plant sources. Its CAS number, 1429-30-7, is a unique identifier that aids in the identification and study of this specific anthocyanin in scientific literature and databases.
Formula:C16H13O7·Cl
InChI:InChI=1S/C16H12O7.ClH/c1-22-14-3-7(2-11(19)15(14)21)16-12(20)6-9-10(18)4-8(17)5-13(9)23-16;/h2-6H,1H3,(H4-,17,18,19,20,21);1H
InChI key:InChIKey=QULMBDNPZCFSPR-UHFFFAOYSA-N
SMILES:[Cl-].OC=1C=C(O)C=2C=C(O)C(=[O+]C2C1)C=3C=C(O)C(O)=C(OC)C3
- Synonyms:
- 1-Benzopyrylium, 2-(3,4-dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxy-, chloride
- 1-Benzopyrylium, 2-(3,4-dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxy-, chloride (1:1)
- 2-(3,4-Dihydroxy-5-Methoxyphenyl)-3,5,7-Trihydroxychromenium Chloride
- 2-(3,4-Dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxy-1-benzopyryliumchloride
- 3,3',4',5,7-Pentahydroxy-5'-methoxyflavylium chloride (7CI)
- 3,3′,4′,5,7-Pentahydroxy-5′-methoxyflavylium chloride
- Flavylium, 3,3',4',5,7-pentahydroxy-5'-methoxy-, chloride (8CI)
- Flavylium, 3,3′,4′,5,7-pentahydroxy-5′-methoxy-, chloride
- Nsc 11907
- Petunidin
- See more synonyms
- Petunidin (6CI)
- Petunidin chloride
- Petunidol
- Petunidol chloride
- 2-(3,4-Dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxy-1-benzopyrylium chloride
