CAS 14290-86-9
:trans-4-Fluorocinnamic acid
Description:
Trans-4-Fluorocinnamic acid is an organic compound characterized by its trans configuration around the double bond between the carbon atoms in the cinnamic acid structure. It features a fluorine atom substituted at the para position of the phenyl ring relative to the carboxylic acid group. This compound typically appears as a white to off-white crystalline solid and is known for its moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water. Trans-4-Fluorocinnamic acid exhibits interesting chemical properties, including the ability to undergo various reactions typical of carboxylic acids, such as esterification and decarboxylation. Its fluorine substitution can influence its reactivity and biological activity, making it of interest in medicinal chemistry and materials science. Additionally, it may serve as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The compound's melting point and boiling point, along with its spectral data, can provide further insights into its structural characteristics and purity.
Formula:C9H7FO2
InChI:InChI=1S/C9H7FO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H,11,12)/b6-3+
InChI key:InChIKey=ISMMYAZSUSYVQG-ZZXKWVIFSA-N
SMILES:C(=C/C(O)=O)\C1=CC=C(F)C=C1
Synonyms:- 2-Propenoic acid, 3-(4-fluorophenyl)-, (E)-
- (E)-4-Fluorocinnamic acid
- 2-Propenoic acid, 3-(4-fluorophenyl)-, (2E)-
- (2E)-3-(4-Fluorophenyl)-2-propenoic acid
- Cinnamic acid, p-fluoro-, (E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(E)-3-(4-Fluorophenyl)acrylic acid
CAS:<p>(E)-3-(4-Fluorophenyl)acrylic acid is a cinnamic acid derivative that is activated by trifluoroacetic acid. It has been shown to be effective in the treatment of wastewater containing high levels of organic matter, as well as bacterial strains found in sewage and clinical samples. This compound also inhibits lung fibroblasts and lung cancer cells, with an effective dose at less than 1 mM. (E)-3-(4-Fluorophenyl)acrylic acid has potent inhibitory activity against tumour cells and has been shown to inhibit gene expression. In addition, this compound shows kinetic effects on the hl-60 cell line.</p>Formula:C9H7FO2Purity:Min. 95%Molecular weight:166.15 g/mol
