CymitQuimica logo

CAS 1429056-24-5

:

1-Ethyl-4-(1,1,2,2,2-pentafluoroethyl)benzene

Description:
1-Ethyl-4-(1,1,2,2,2-pentafluoroethyl)benzene is an organic compound characterized by its unique structure, which includes a benzene ring substituted with an ethyl group and a pentafluoroethyl group. The presence of multiple fluorine atoms in the pentafluoroethyl moiety imparts significant chemical stability and alters the compound's physical properties, such as increasing its hydrophobicity and thermal stability. This compound is likely to exhibit low volatility and high density due to the heavy fluorinated substituent. Additionally, the fluorinated groups can influence the compound's reactivity, making it less susceptible to oxidation and other chemical transformations compared to non-fluorinated analogs. Its applications may span various fields, including materials science and pharmaceuticals, particularly in the development of specialty chemicals or as intermediates in synthesis. However, specific safety and handling guidelines should be followed due to the potential environmental and health impacts associated with fluorinated compounds.
Formula:C10H9F5
InChI:InChI=1S/C10H9F5/c1-2-7-3-5-8(6-4-7)9(11,12)10(13,14)15/h3-6H,2H2,1H3
InChI key:InChIKey=QGVKCSXJGQWSCA-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(F)(F)C1=CC=C(CC)C=C1
Synonyms:
  • 1-Ethyl-4-(1,1,2,2,2-pentafluoroethyl)benzene
  • Benzene, 1-ethyl-4-(1,1,2,2,2-pentafluoroethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.