CymitQuimica logo

CAS 1429056-29-0

:

2-Chloro-5-(1,1,2,2,2-pentafluoroethyl)thiophene

Description:
2-Chloro-5-(1,1,2,2,2-pentafluoroethyl)thiophene is a specialized chemical compound characterized by its unique structure, which includes a thiophene ring substituted with a chlorine atom and a pentafluoroethyl group. The presence of the thiophene moiety imparts aromatic properties, while the chlorine substitution enhances its reactivity and potential for further chemical modifications. The pentafluoroethyl group contributes to the compound's hydrophobicity and volatility, making it of interest in various applications, including materials science and organic synthesis. This compound is likely to exhibit distinct physical properties, such as a specific melting and boiling point, and may demonstrate unique reactivity patterns due to the combination of halogen and fluorinated substituents. Additionally, its fluorinated nature may confer stability against thermal degradation and chemical reactions, making it suitable for use in specialized environments. Safety and handling precautions are essential due to the presence of chlorine and fluorine, which can pose health and environmental risks.
Formula:C6H2ClF5S
InChI:InChI=1S/C6H2ClF5S/c7-4-2-1-3(13-4)5(8,9)6(10,11)12/h1-2H
InChI key:InChIKey=SLSJEDLMFJIWGB-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(F)(F)C=1SC(Cl)=CC1
Synonyms:
  • Thiophene, 2-chloro-5-(1,1,2,2,2-pentafluoroethyl)-
  • 2-Chloro-5-(1,1,2,2,2-pentafluoroethyl)thiophene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.