CAS 1429056-34-7

2,4-Dimethyl-1-(1,1,2,2,2-pentafluoroethyl)benzene

Description:

2,4-Dimethyl-1-(1,1,2,2,2-pentafluoroethyl)benzene, with the CAS number 1429056-34-7, is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with two methyl groups and a pentafluoroethyl group. The presence of the pentafluoroethyl substituent imparts significant fluorine content, which can enhance the compound's chemical stability and hydrophobicity. This compound is likely to exhibit low volatility and high thermal stability due to the strong C-F bonds associated with the fluorinated group. Additionally, the methyl groups contribute to the compound's steric hindrance, potentially influencing its reactivity and interactions with other molecules. The unique combination of these substituents may also affect its solubility in various solvents, making it of interest in fields such as materials science and organic synthesis. However, specific physical properties such as boiling point, melting point, and solubility would require empirical data for precise characterization.

Formula: C₁₀H₉F₅

InChI: InChI=1S/C10H9F5/c1-6-3-4-8(7(2)5-6)9(11,12)10(13,14)15/h3-5H,1-2H3

InChI key: InChIKey=MLIGMUPRMUETLS-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(F)(F)C1=C(C)C=C(C)C=C1

Synonyms:

• Benzene, 2,4-dimethyl-1-(1,1,2,2,2-pentafluoroethyl)-
• 2,4-Dimethyl-1-(1,1,2,2,2-pentafluoroethyl)benzene

2,4-Dimethyl-pentafluoroethylbenzene

CAS: 1429056-34-7

Formula: C₁₀H₉F₅

Molecular weight: 224.174

Ref: 10-F094409