CAS 1429056-46-1
:2-Chloro-1-fluoro-4-(1,1,2,2,2-pentafluoroethyl)benzene
Description:
2-Chloro-1-fluoro-4-(1,1,2,2,2-pentafluoroethyl)benzene is a halogenated aromatic compound characterized by the presence of both chlorine and fluorine substituents on a benzene ring. The structure features a chloro group and a fluoro group at the 1 and 2 positions, respectively, while a pentafluoroethyl group is attached at the para position (4). This compound is likely to exhibit significant hydrophobicity due to the presence of multiple fluorine atoms, which can influence its solubility and volatility. The presence of halogens typically enhances the compound's stability and may impart unique reactivity patterns, making it of interest in various chemical applications, including as a potential intermediate in organic synthesis or in materials science. Additionally, the fluorinated groups can affect the compound's electronic properties, potentially making it useful in specialized applications such as pharmaceuticals or agrochemicals. Safety and handling considerations are important due to the toxicity associated with halogenated compounds, necessitating appropriate precautions during use.
Formula:C8H3ClF6
InChI:InChI=1S/C8H3ClF6/c9-5-3-4(1-2-6(5)10)7(11,12)8(13,14)15/h1-3H
InChI key:InChIKey=LBIMJSYYFJJFRC-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(F)(F)C1=CC(Cl)=C(F)C=C1
Synonyms:- 2-Chloro-1-fluoro-4-(pentafluoroethyl)benzene
- 2-Chloro-1-fluoro-4-(1,1,2,2,2-pentafluoroethyl)benzene
- Benzene, 2-chloro-1-fluoro-4-(1,1,2,2,2-pentafluoroethyl)-
- 2-Chloro-1-fluoro-4-pentafluoroethyl-benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
