CAS 14292-29-6
:3-Hydroxyadipic acid
Description:
3-Hydroxyadipic acid, with the CAS number 14292-29-6, is a dicarboxylic acid characterized by the presence of two carboxyl (-COOH) groups and a hydroxyl (-OH) group on its carbon chain. It is an isomer of adipic acid, differing in the position of the hydroxyl group. This compound typically appears as a white crystalline solid and is soluble in water due to its polar functional groups. The presence of both hydroxyl and carboxylic acid groups allows for various chemical reactivity, making it useful in the synthesis of polyesters and other polymers. Additionally, 3-hydroxyadipic acid can serve as a building block in organic synthesis and may have applications in the production of biodegradable materials. Its properties, such as melting point and boiling point, can vary based on purity and environmental conditions. Overall, 3-hydroxyadipic acid is significant in both industrial applications and research contexts, particularly in the development of sustainable materials.
Formula:C6H10O5
InChI:InChI=1S/C6H10O5/c7-4(3-6(10)11)1-2-5(8)9/h4,7H,1-3H2,(H,8,9)(H,10,11)
InChI key:InChIKey=YVOMYDHIQVMMTA-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)(CC(O)=O)O
Synonyms:- 3-Hydroxyadipic acid
- Hexanedioic acid, 3-hydroxy-
- 3-Hydroxyhexanedioic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-Hydroxyhexanedioic Acid
CAS:Controlled ProductApplications 3-Hydroxyhexanedioic Acid gets excreted in increased amounts in the human urine under conditions of medium-chain triglyceride (MCT) feeding, abnormal fatty acid oxidation (FAO) and fasting.
References Duran, M., et al.: Eur. J. Pediatr., 150, 190 (1991); Svendsen, J. S., et al.: J. Chromatogr. B., 337, 9 (1985); Tserng, K. Y., et al.: Metabolism, 40, 676 (1991); Tserng, K. Y., et al.: Metabolism, 445, 162 (1996)Formula:C6H10O5Color and Shape:White SolidMolecular weight:162.14

