CAS 14292-44-5

5,6,7,8-TETRAHYDRO-4H-CYCLOHEPTA[D][1,3]THIAZOL-2-AMINE

Description:

5,6,7,8-Tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-amine is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both sulfur and nitrogen atoms. This compound features a thiazole ring fused to a cycloheptane framework, contributing to its distinctive chemical properties. The presence of the amine functional group indicates potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry and organic synthesis. Its tetrahydro configuration suggests that it is saturated, which may influence its stability and solubility in various solvents. The compound's molecular structure allows for potential interactions with biological targets, which could be explored for pharmaceutical applications. Additionally, the specific arrangement of atoms and functional groups may impart unique electronic properties, affecting its reactivity and potential uses in chemical reactions. Overall, 5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-amine represents a fascinating subject for further research in both synthetic and medicinal chemistry.

Formula: C₈H₁₂N₂S

InChI: InChI=1/C8H12N2S/c9-8-10-6-4-2-1-3-5-7(6)11-8/h1-5H2,(H2,9,10)

SMILES: C1CCc2c(CC1)sc(=N)[nH]2

Synonyms:

• 4H-Cyclohepta[d]thiazol-2-amine, 5,6,7,8-tetrahydro-
• 5,6,7,8-Tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-amine

5,6,7,8-Tetrahydro-4h-cyclohepta[d][1,3]thiazol-2-amine

CAS: 14292-44-5

Formula: C₈H₁₂N₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 168.2593

Ref: IN-DA009DSY

5,6,7,8-Tetrahydro-4h-cyclohepta[d][1,3]thiazol-2-amine

CAS: 14292-44-5

5,6,7,8-Tetrahydro-4h-cyclohepta[d][1,3]thiazol-2-amine

Purity: 98%

Molecular weight: 168.26g/mol

Ref: 54-OR94775

5,6,7,8-Tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-amine

CAS: 14292-44-5

Formula: C₈H₁₂N₂S

Purity: 98%

Molecular weight: 168.26

Ref: 10-F042098