CAS 142928-28-7
:(2E,10E)-12-hydroxy-1-(hydroxymethyl)dodeca-2,10-diene-4,6,8-triyn-1-yl beta-D-glucopyranoside
Description:
(2E,10E)-12-hydroxy-1-(hydroxymethyl)dodeca-2,10-diene-4,6,8-triyn-1-yl beta-D-glucopyranoside, with CAS number 142928-28-7, is a complex organic compound characterized by its unique structure, which includes multiple functional groups and a glycosidic linkage. This compound features a dodeca-diene backbone with three alkyne groups, contributing to its reactivity and potential applications in organic synthesis. The presence of hydroxyl groups enhances its solubility in polar solvents and may impart biological activity, making it of interest in medicinal chemistry. The beta-D-glucopyranoside moiety suggests that it may interact with biological systems, potentially serving as a substrate or inhibitor in enzymatic reactions. Its stereochemistry, indicated by the E configuration at specific double bonds, is crucial for its biological activity and interaction with other molecules. Overall, this compound exemplifies the complexity and diversity of natural products, with potential implications in pharmacology and biochemistry. Further studies would be necessary to elucidate its specific properties and applications.
Formula:C19H22O8
InChI:InChI=1/C19H22O8/c20-11-9-7-5-3-1-2-4-6-8-10-14(12-21)26-19-18(25)17(24)16(23)15(13-22)27-19/h7-10,14-25H,11-13H2/b9-7+,10-8+/t14?,15-,16-,17+,18-,19-/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(3E,11E)-Tridecadiene-6,8,10-Triyne-1,13-diol-2-O-ß-D-Glucopyranoside
CAS:Formula:C19H22O8Molecular weight:378.38Ref: 4Z-T-269001
Discontinued product
