CAS 14293-06-2
:5-benzylpyrrolidin-2-one
Description:
5-Benzylpyrrolidin-2-one, also known as N-benzyl-2-pyrrolidinone, is a cyclic amide characterized by a pyrrolidine ring with a benzyl group attached to the nitrogen atom. This compound features a five-membered ring structure that includes one carbonyl group, contributing to its classification as a lactam. It is typically a white to off-white solid at room temperature and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water. The presence of the benzyl group enhances its lipophilicity, which can influence its biological activity and potential applications in medicinal chemistry. 5-Benzylpyrrolidin-2-one may exhibit various pharmacological properties, making it of interest in drug development and synthesis. Additionally, its structural characteristics allow for potential modifications that can lead to derivatives with enhanced efficacy or selectivity. As with many organic compounds, safety and handling precautions should be observed, as the compound may pose health risks if ingested or inhaled.
Formula:C11H13NO
InChI:InChI=1/C11H13NO/c13-11-7-6-10(12-11)8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,12,13)
SMILES:c1ccc(cc1)CC1CCC(=N1)O
Synonyms:- 2-Pyrrolidinone, 5-(Phenylmethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
5-Benzylpyrrolidin-2-one
CAS:5-Benzylpyrrolidin-2-one (5BP) is a small molecule that has been shown to have potent inhibition of boophilus, as well as other related species. The 5BP inhibits the target enzymes in the respiratory electron transport chain and blocks the flow of electrons from cytochrome C1, which is an important component of this system. This leads to an increase in hydrogen ions, which causes a change in the pH, and consequently an increase in blood pressure. In addition, 5BP binds to DNA and forms covalent adducts with cytosine nucleobases. These adducts can be used as molecular targets for designing drugs that are effective against cancer cells. 5BP is also a potent inhibitor of cancer cells, including human melanoma cells and human prostate carcinoma cells. There is evidence that this drug may be effective against marine microorganisms such as Vibrio spp., which causes cholera.Formula:C11H13NOPurity:Min. 95%Molecular weight:175.23 g/mol
