CAS 14293-67-5
:Sulfuric acid, iridium(3+) salt (3:2)
Description:
Sulfuric acid, iridium(3+) salt (3:2), with the CAS number 14293-67-5, is a coordination compound that features iridium in a +3 oxidation state complexed with sulfate ions derived from sulfuric acid. This compound typically exhibits characteristics associated with transition metal salts, including potential catalytic properties and varied solubility depending on the solvent. Iridium(3+) salts are known for their stability and ability to participate in redox reactions, making them valuable in various chemical applications, including catalysis and materials science. The presence of sulfuric acid in the formula suggests that the compound may also exhibit acidic properties, influencing its reactivity and interactions with other substances. Additionally, iridium compounds are often characterized by their unique electronic configurations, which can lead to interesting optical and electronic properties. Overall, this compound is of interest in both industrial and research settings, particularly in fields involving catalysis and advanced materials.
Formula:H2O4SIr
InChI:InChI=1S/Ir.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)
InChI key:InChIKey=YESAPVFTAYLNBZ-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)O.[Ir]
Synonyms:- Iridium sulfate (Ir<sub>2</sub>(SO<sub>4</sub>)<sub>3</sub>)
- Iridium(3+) Sulfate (2:3)
- Sulfuric acid, iridium(3+) salt (3:2)
- Iridium sulfate (Ir2(SO4)3)
- Diiridium(3+) trisulphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
