CAS 142937-50-6
:Triptoquinone B
Description:
Triptoquinone B, with the CAS number 142937-50-6, is a chemical compound that belongs to the class of quinones, which are characterized by their conjugated cyclic structures containing two carbonyl groups. This compound is derived from natural sources, particularly from certain fungi and plants, and is known for its potential biological activities. Triptoquinone B exhibits properties such as antioxidant activity and may play a role in various biochemical processes. Its structure typically includes a fused ring system, contributing to its stability and reactivity. The compound is of interest in medicinal chemistry due to its potential therapeutic applications, including antimicrobial and anticancer properties. Additionally, its unique chemical characteristics make it a subject of study in the field of natural product chemistry. As with many quinones, Triptoquinone B may also participate in redox reactions, which can influence its behavior in biological systems. Overall, its diverse properties make it a valuable compound for further research in both synthetic and natural product chemistry.
Formula:C20H26O4
InChI:InChI=1S/C20H26O4/c1-11(2)13-9-14(22)17-12(18(13)24)5-6-15-19(17,3)8-7-16(23)20(15,4)10-21/h9,11,15,21H,5-8,10H2,1-4H3/t15-,19+,20-/m1/s1
InChI key:InChIKey=RYYRZMIBKOKIRO-UIAACRFSSA-N
SMILES:C[C@@]12C3=C(C(=O)C(C(C)C)=CC3=O)CC[C@]1([C@](CO)(C)C(=O)CC2)[H]
Synonyms:- (+)-Triptoquinone B
- (4bS,8S,8aR)-5,6,8,8a,9,10-Hexahydro-8-(hydroxymethyl)-4b,8-dimethyl-2-(1-methylethyl)-1,4,7(4bH)-phenanthrenetrione
- 1,4,7(4bH)-Phenanthrenetrione,5,6,8,8a,9,10-hexahydro-8-(hydroxymethyl)-4b,8-dimethyl-2-(1-methylethyl)-,[4bS-(4ba,8a,8ab)]-
- 1,4,7(4bH)-Phenanthrenetrione, 5,6,8,8a,9,10-hexahydro-8-(hydroxymethyl)-4b,8-dimethyl-2-(1-methylethyl)-, (4bS,8S,8aR)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Triptoquinone B
CAS:<p>Triptoquinone B is a novel interleukin-1 inhibitor, shows extremely potent inhibitory activities against interleukin-lα and β releases for human peripheral</p>Formula:C20H26O4Purity:98%Color and Shape:SolidMolecular weight:330.42Triptoquinone B
CAS:Controlled Product<p>Triptoquinone B is a bioactive quinone compound, which is derived from marine sponges. Specifically, these compounds are isolated from species that inhabit coral reefs, showcasing the remarkable chemical diversity found in marine environments. The mode of action of Triptoquinone B involves interference with cellular processes through modulation of enzymatic activities, particularly those responsible for critical metabolic pathways. This disruption may lead to antiproliferative effects on certain pathogenic organisms or cancer cells.</p>Formula:C20H26O4Purity:Min. 95%Molecular weight:330.4 g/mol



