CAS 142937-55-1
:4,5-Dihydroxy-2,3-pentanedione
Description:
4,5-Dihydroxy-2,3-pentanedione, also known as a diketone, is an organic compound characterized by the presence of two hydroxyl (-OH) groups and two carbonyl (C=O) groups within its five-carbon chain structure. This compound typically exhibits a pale yellow to colorless appearance and is soluble in water due to its hydroxyl groups, which can engage in hydrogen bonding. The presence of both hydroxyl and carbonyl functionalities allows for a range of chemical reactivity, including potential participation in condensation reactions and the formation of chelates with metal ions. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and organic synthesis. Additionally, the compound may exhibit antioxidant properties, making it of interest in biochemical research. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H8O4
InChI:InChI=1S/C5H8O4/c1-3(7)5(9)4(8)2-6/h4,6,8H,2H2,1H3
InChI key:InChIKey=UYTRITJAZOPLCZ-UHFFFAOYSA-N
SMILES:C(C(CO)O)(C(C)=O)=O
Synonyms:- DPD
- 1-Deoxypento-2,4-diulose
- 4,5-Dihydroxy-2,3-pentanedione
- 2,3-Pentanedione, 4,5-dihydroxy-
- 1-Deoxypentosone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4,5-Dihydroxy-2,3-pentanedione, 1mg/ml aqueous solution
CAS:<p>Please enquire for more information about 4,5-Dihydroxy-2,3-pentanedione, 1mg/ml aqueous solution including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C5H8O4Molecular weight:132.11 g/mol4,5-Dihydroxy-2,3-Pentanedione
CAS:<p>4,5-Dihydroxy-2,3-pentanedione is a carbonyl compound that is the product of the oxidation of ascorbic acid. It is used in wastewater treatment and has antimicrobial properties against infectious diseases. This compound has been shown to inhibit protein synthesis by binding to the ribosome and preventing the formation of peptide bonds between amino acids. 4,5-Dihydroxy-2,3-pentanedione has also been shown to bind to plasma proteins, which may be due to its acyl chain structure. 4,5-Dihydroxy-2,3-pentanedione can be synthesized in a catalytic mechanism that involves dehydroascorbic acid and molecular oxygen.</p>Formula:C5H8O4Purity:Min. 95%Color and Shape:PowderMolecular weight:132.11 g/mol
