CAS 1429417-54-8

4-Bromo-1-(2-fluoroethyl)-1H-pyrazole-3-carboxylic acid

Description:

4-Bromo-1-(2-fluoroethyl)-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a fluoroethyl group at the 1-position contributes to its unique reactivity and potential applications in medicinal chemistry. The carboxylic acid functional group at the 3-position enhances its acidity and solubility in polar solvents, making it suitable for various chemical reactions and biological interactions. This compound may exhibit interesting biological activities due to the presence of halogen substituents, which can influence its pharmacokinetic properties. Additionally, the specific arrangement of functional groups can lead to diverse applications in agrochemicals or pharmaceuticals. As with many pyrazole derivatives, it may also serve as a scaffold for the development of new therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₆H₆BrFN₂O₂

InChI: InChI=1S/C6H6BrFN2O2/c7-4-3-10(2-1-8)9-5(4)6(11)12/h3H,1-2H2,(H,11,12)

InChI key: InChIKey=AUISQCCJZMYNLN-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=NN(CCF)C=C1Br

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 4-bromo-1-(2-fluoroethyl)-
• 4-Bromo-1-(2-fluoroethyl)-1H-pyrazole-3-carboxylic acid

4-Bromo-1-(2-fluoroethyl)-1H-pyrazole-3-carboxylic acid

CAS: 1429417-54-8

Versatile small molecule scaffold

Formula: C₆H₆BrFN₂O₂

Purity: Min. 95%

Molecular weight: 237.03 g/mol

Ref: 3D-EHC41754