CAS 1429417-57-1

1-(2-Fluoroethyl)-1H-pyrazole-5-methanol

Description:

1-(2-Fluoroethyl)-1H-pyrazole-5-methanol is a chemical compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a fluoroethyl group indicates that it has a fluorine atom attached to a two-carbon ethyl chain, which can influence its reactivity and biological activity. The methanol moiety suggests the presence of a hydroxymethyl group, which can participate in hydrogen bonding and may enhance solubility in polar solvents. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, and the fluorine atom can enhance metabolic stability and lipophilicity. As with many pyrazole derivatives, it may be investigated for applications in agrochemicals or pharmaceuticals. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₆H₉FN₂O

InChI: InChI=1S/C6H9FN2O/c7-2-4-9-6(5-10)1-3-8-9/h1,3,10H,2,4-5H2

InChI key: InChIKey=NGITXENVHSFDTR-UHFFFAOYSA-N

SMILES: C(CF)N1C(CO)=CC=N1

Synonyms:

• 1H-Pyrazole-5-methanol, 1-(2-fluoroethyl)-
• 1-(2-Fluoroethyl)-1H-pyrazole-5-methanol

[1-(2-Fluoroethyl)-1H-pyrazol-5-yl]methanol

CAS: 1429417-57-1

Versatile small molecule scaffold

Formula: C₆H₉FN₂O

Purity: Min. 95%

Molecular weight: 144.15 g/mol

Ref: 3D-EHC41757