
CAS 1429418-37-0
:4-[(4-Amino-1-methyl-1H-pyrazol-3-yl)oxy]benzoic acid
Description:
4-[(4-Amino-1-methyl-1H-pyrazol-3-yl)oxy]benzoic acid, with the CAS number 1429418-37-0, is a chemical compound characterized by its unique structural features, which include a benzoic acid moiety and a pyrazole derivative. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for hydrogen bonding due to the presence of amino and carboxylic acid functional groups. The amino group can participate in various chemical reactions, including nucleophilic substitutions, while the carboxylic acid group can engage in acid-base reactions. The presence of the pyrazole ring contributes to its potential biological activity, making it of interest in pharmaceutical research. Additionally, the compound's solubility and reactivity can be influenced by the pH of the environment, which affects the ionization of the carboxylic acid group. Overall, this compound's characteristics suggest potential applications in medicinal chemistry and material science, warranting further investigation into its properties and uses.
Formula:C11H11N3O3
InChI:InChI=1S/C11H11N3O3/c1-14-6-9(12)10(13-14)17-8-4-2-7(3-5-8)11(15)16/h2-6H,12H2,1H3,(H,15,16)
InChI key:InChIKey=QKEGCEZOPSJTHL-UHFFFAOYSA-N
SMILES:O(C1=NN(C)C=C1N)C2=CC=C(C(O)=O)C=C2
Synonyms:- 4-[(4-Amino-1-methyl-1H-pyrazol-3-yl)oxy]benzoic acid
- Benzoic acid, 4-[(4-amino-1-methyl-1H-pyrazol-3-yl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.