CAS 142950-86-5
:Triptoquinone A
Description:
Triptoquinone A, with the CAS number 142950-86-5, is a naturally occurring chemical compound classified as a quinone. It is derived from the fungal species *Penicillium* and is known for its distinctive structural features, including a conjugated system that contributes to its reactivity and potential biological activity. Triptoquinone A exhibits properties typical of quinones, such as the ability to undergo redox reactions, which can lead to the formation of reactive intermediates. This compound has garnered interest in the field of medicinal chemistry due to its potential pharmacological applications, including antimicrobial and anticancer activities. Its solubility characteristics may vary depending on the solvent, and it may exhibit fluorescence under certain conditions. As with many quinones, Triptoquinone A's reactivity can be influenced by environmental factors, making it a subject of study in both synthetic and natural product chemistry. Further research is necessary to fully elucidate its mechanisms of action and potential therapeutic uses.
Formula:C20H24O4
InChI:InChI=1S/C20H24O4/c1-10(2)14-9-16(21)17-13(18(14)22)5-6-15-11(3)12(19(23)24)7-8-20(15,17)4/h9-10,15H,5-8H2,1-4H3,(H,23,24)/t15-,20-/m0/s1
InChI key:InChIKey=PDPFWAJAYGLYHD-YWZLYKJASA-N
SMILES:C[C@@]12C3=C(C(=O)C(C(C)C)=CC3=O)CC[C@]1(C(C)=C(C(O)=O)CC2)[H]
Synonyms:- (4aS,10aS)-1,4a-dimethyl-5,8-dioxo-7-(propan-2-yl)-3,4,4a,5,8,9,10,10a-octahydrophenanthrene-2-carboxylic acid
- (4aS,10aS)-3,4,4a,5,8,9,10,10a-Octahydro-1,4a-dimethyl-7-(1-methylethyl)-5,8-dioxo-2-phenanthrenecarboxylic acid
- (4aS-trans)-3,4,4a,5,8,9,10,10a-Octahydro-1,4a-dimethyl-7-(1-methylethyl)-5,8-dioxo-2-phenanthrenecarboxylic acid
- 2-Phenanthrenecarboxylic acid, 3,4,4a,5,8,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-5,8-dioxo-, (4aS,10aS)-
- 2-Phenanthrenecarboxylic acid, 3,4,4a,5,8,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-5,8-dioxo-, (4aS-trans)-
- Triptoquinonoic acid A
- Tryptoquinone A
- Triptoquinone A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Triptoquinone A
CAS:Triptoquinone A inhibits iNOS gene, has anti-inflammatory properties, and blocks nitric oxide synthase in vascular muscles.Formula:C20H24O4Purity:98%Color and Shape:SolidMolecular weight:328.4Triptoquinone A
CAS:Controlled Product<p>Triptoquinone A is a monocarboxylic acid that has been shown to have a suppressive effect on cancer cells. It is structurally related to tripterygium, which is a quinoline derivative. Triptoquinone A has been shown to inhibit the production of cGMP in cancer cells by interacting with the aromatase enzyme and causing an increased accumulation of intracellular hydrogen ions. The fluorescence assay, which is a technique used to measure the rate of conversion of quinoline derivatives into terpenes, showed that Triptoquinone A also inhibits tumor growth in mice with muscle cancer.</p>Formula:C20H24O4Purity:Min. 95%Molecular weight:328.4 g/mol


