CymitQuimica logo

CAS 142976-45-2

:

(2R)-2-[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]propan-1-ol

Description:
The chemical substance known as (2R)-2-[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]propan-1-ol, with the CAS number 142976-45-2, is a chiral compound characterized by its specific stereochemistry, which plays a crucial role in its biological activity and interactions. This compound features a tetrahydroisoquinoline moiety, which is a common structural framework in various bioactive molecules, particularly in pharmaceuticals. The presence of methoxy groups enhances its lipophilicity, potentially influencing its pharmacokinetic properties. The propanol side chain contributes to its solubility and reactivity. As a chiral molecule, it can exist in two enantiomeric forms, which may exhibit different biological effects. The compound's potential applications could span across medicinal chemistry, particularly in the development of drugs targeting neurological or psychological conditions, given the structural similarities to known psychoactive substances. However, specific biological activities, toxicity, and therapeutic potential would require further investigation through experimental studies.
Formula:C14H21NO3
InChI:InChI=1/C14H21NO3/c1-9(8-16)14-11-7-13(18-3)12(17-2)6-10(11)4-5-15-14/h6-7,9,14-16H,4-5,8H2,1-3H3/t9-,14+/m0/s1
Found 1 products.