CAS 142977-64-8

α,α-Difluorobenzenepropanoic acid

Description:

α,α-Difluorobenzenepropanoic acid, identified by its CAS number 142977-64-8, is an organic compound characterized by the presence of a propanoic acid moiety substituted with two fluorine atoms at the alpha position relative to the carboxylic acid group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential polarity due to the carboxylic acid functional group. The fluorine substituents can influence the compound's reactivity, stability, and solubility, often enhancing its lipophilicity and altering its interaction with biological systems. As a difluorinated derivative, it may also exhibit unique chemical behavior, such as increased acidity compared to its non-fluorinated counterparts. The presence of the aromatic ring contributes to its potential applications in pharmaceuticals and agrochemicals, where fluorinated compounds are often sought for their enhanced biological activity and metabolic stability. Overall, α,α-Difluorobenzenepropanoic acid represents a compound of interest in both synthetic chemistry and medicinal applications.

Formula: C₉H₈F₂O₂

InChI: InChI=1S/C9H8F2O2/c10-9(11,8(12)13)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,12,13)

InChI key: InChIKey=WHXXGJROBAJWOW-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)(F)F)C1=CC=CC=C1

Synonyms:

• 2,2-Difluoro-3-phenylpropanoic acid
• Benzenepropanoic acid, α,α-difluoro-
• α,α-Difluorobenzenepropanoic acid

2,2-difluoro-3-phenylpropanoic acid

Controlled Product

CAS: 142977-64-8

Applications 2,2-difluoro-3-phenylpropanoic acid (cas# 142977-64-8) is a useful research chemical.

Formula: C₉H₈O₂F₂

Color and Shape: Neat

Molecular weight: 186.16

Ref: TR-D455173

2,2-Difluoro-3-phenylpropanoic acid

CAS: 142977-64-8

Versatile small molecule scaffold

Formula: C₉H₈F₂O₂

Purity: Min. 95%

Molecular weight: 186.15 g/mol

Ref: 3D-SFA97764