CymitQuimica logo

CAS 14299-54-8

:

2,4,5-trichlorophenylethanol

Description:
2,4,5-Trichlorophenylethanol is an organic compound characterized by its chlorinated phenolic structure. It features a phenyl ring substituted with three chlorine atoms at the 2, 4, and 5 positions, along with an ethanol group attached to the carbon adjacent to the phenyl ring. This compound is typically a white to off-white solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for chlorinated compounds. The presence of chlorine atoms contributes to its biological activity and potential toxicity, making it important to handle with care. Additionally, 2,4,5-trichlorophenylethanol may undergo various chemical reactions typical of phenolic compounds, including oxidation and substitution reactions. Its environmental persistence and potential effects on human health and ecosystems are subjects of ongoing research, particularly concerning its role as a contaminant in certain settings.
Formula:C8H7Cl3O
InChI:InChI=1/C8H7Cl3O/c1-4(12)5-2-7(10)8(11)3-6(5)9/h2-4,12H,1H3
SMILES:CC(c1cc(c(cc1Cl)Cl)Cl)O
Synonyms:
  • Benzenemethanol, 2,4,5-trichloro-alpha-methyl-
  • 1-(2,4,5-Trichlorophenyl)Ethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.