CAS 1429901-00-7

2-Methyl-5-propyl-4-thiazolecarboxylic acid

Description:

2-Methyl-5-propyl-4-thiazolecarboxylic acid is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the methyl and propyl groups on the thiazole ring influences its solubility and reactivity, making it more hydrophobic compared to simpler thiazole derivatives. The thiazole moiety is known for its biological activity, often found in various natural products and pharmaceuticals. This compound may exhibit antimicrobial or antifungal properties, typical of many thiazole derivatives. Its synthesis typically involves the reaction of appropriate thiazole precursors with carboxylic acid derivatives. The compound's stability, reactivity, and potential applications in medicinal chemistry or agriculture can be influenced by the specific arrangement of its substituents. As with many organic acids, it may participate in acid-base reactions, forming salts or esters under suitable conditions. Overall, 2-Methyl-5-propyl-4-thiazolecarboxylic acid represents a structurally interesting compound with potential utility in various chemical and biological contexts.

Formula: C₈H₁₁NO₂S

InChI: InChI=1S/C8H11NO2S/c1-3-4-6-7(8(10)11)9-5(2)12-6/h3-4H2,1-2H3,(H,10,11)

InChI key: InChIKey=FQLSSDHQSSYJBO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(CCC)SC(C)=N1

Synonyms:

• 2-Methyl-5-propyl-4-thiazolecarboxylic acid
• 4-Thiazolecarboxylic acid, 2-methyl-5-propyl-

2-Methyl-5-propyl-1,3-thiazole-4-carboxylic acid

CAS: 1429901-00-7

Versatile small molecule scaffold

Formula: C₈H₁₁NO₂S

Purity: Min. 95%

Molecular weight: 185.25 g/mol

Ref: 3D-EHC90100