CAS 143016-69-7

2-Pyridinemethanol, 3,5-dimethyl-4-nitro-, hydrochloride (1:1)

Description:

2-Pyridinemethanol, 3,5-dimethyl-4-nitro-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a hydroxymethyl group (-CH2OH) attached to the pyridine, along with two methyl groups at the 3 and 5 positions and a nitro group (-NO2) at the 4 position, contributing to its unique reactivity and properties. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and other polar solvents. The presence of the nitro group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to participate in various chemical reactions. Additionally, the compound may exhibit biological activity, making it of interest in research related to drug design and synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₈H₁₀N₂O₃·ClH

InChI: InChI=1S/C8H10N2O3.ClH/c1-5-3-9-7(4-11)6(2)8(5)10(12)13;/h3,11H,4H2,1-2H3;1H

InChI key: InChIKey=XJBKLMJRLAGGFP-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C(C)=C(CO)N=CC1C.Cl

Synonyms:

• 2-Pyridinemethanol, 3,5-dimethyl-4-nitro-, monohydrochloride
• 2-Pyridinemethanol, 3,5-dimethyl-4-nitro-, hydrochloride (1:1)
• (3,5-Dimethyl-4-nitropyridin-2-yl)methanol hydrochloride