CAS 1430223-92-9: 2,5-Difluoro-4-(4-morpholinyl)benzoic acid

Description:2,5-Difluoro-4-(4-morpholinyl)benzoic acid is a chemical compound characterized by its unique molecular structure, which includes a benzoic acid core substituted with two fluorine atoms at the 2 and 5 positions and a morpholine group at the para position. This compound is typically a solid at room temperature and exhibits properties common to aromatic carboxylic acids, such as acidity due to the carboxyl functional group. The presence of fluorine atoms enhances its lipophilicity and may influence its reactivity and biological activity. The morpholine moiety contributes to its potential as a pharmacophore, making it of interest in medicinal chemistry for developing therapeutic agents. Additionally, the compound may exhibit specific solubility characteristics in various solvents, which can be important for its application in drug formulation or chemical synthesis. Overall, 2,5-Difluoro-4-(4-morpholinyl)benzoic acid is notable for its structural features that may impart unique chemical and biological properties.

Formula:C₁₁H₁₁F₂NO₃

InChI:InChI=1S/C11H11F2NO3/c12-8-6-10(14-1-3-17-4-2-14)9(13)5-7(8)11(15)16/h5-6H,1-4H2,(H,15,16)

InChI key:InChIKey=FHZWGXCSLFMTNO-UHFFFAOYSA-N

SMILES:O=C(O)C1=CC(F)=C(C=C1F)N2CCOCC2