CAS 143060-31-5
:N-(tert-Butoxycarbonyl)-3-phenyl-D-phenylalanine
Description:
N-(tert-Butoxycarbonyl)-3-phenyl-D-phenylalanine, commonly referred to as Boc-D-phenylalanine, is an amino acid derivative characterized by the presence of a tert-butoxycarbonyl (Boc) protecting group on the amino group of D-phenylalanine. This compound is typically used in peptide synthesis as a protective group that can be removed under specific conditions, allowing for the selective functionalization of the amino acid. The presence of the phenyl group contributes to its hydrophobic characteristics, influencing solubility and interaction with other molecules. The Boc group enhances the stability of the amino acid during synthesis and can be cleaved using acidic conditions. This compound is often utilized in the development of pharmaceuticals and in the study of peptide interactions due to its structural properties. Its molecular structure allows for various applications in organic synthesis and medicinal chemistry, making it a valuable intermediate in the preparation of more complex peptide structures.
Formula:C20H23NO4
InChI:InChI=1/C20H23NO4/c1-20(2,3)25-19(24)21-17(18(22)23)13-14-8-7-11-16(12-14)15-9-5-4-6-10-15/h4-12,17H,13H2,1-3H3,(H,21,24)(H,22,23)/t17-/m1/s1
SMILES:CC(C)(C)OC(=N[C@H](Cc1cccc(c1)c1ccccc1)C(=O)O)O
Synonyms:- (R)-N-(TERT-BUTOXYCARBONYL)-BETA-PHENYL-PHENYLALN-(tert-Butoxycarbonyl)-beta-phenyl-D-phenylalanine ANINE
- N-(Tert-Butoxycarbonyl)-Beta-Phenyl-D-Phenylalanine
- N-Boc-Beta-Phenyl-D-Phenylalanine
- N-Alpha-T-Butoxycarbonyl-D-3,3-Diphenylalanine
- Boc-D-3,3-Diphenylalanine
- Boc-Beta-Phenyl-D-Phenylalanine
- Boc-D-(3-Phenyl)Phe-Oh
- Boc-D-Dph-Oh
- Boc-D-Ala(3,3-Diphenyl)-Oh
- (R)-N-(Tert-Butoxycarbonyl)-Beta-Phenyl-Phenylalanine
- Boc-3,3-Diphenyl-D-alanine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Boc-β-phenyl-D-phenylalanine, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C20H23NO4Purity:98%Molecular weight:341.4Boc-D-Ala(3,3-diphenyl)-OH
CAS:Formula:C20H23NO4Purity:97%Color and Shape:SolidMolecular weight:341.4009(R)-2-((tert-Butoxycarbonyl)amino)-3,3-diphenylpropanoic acid
CAS:Formula:C20H23NO4Purity:95%Color and Shape:SolidMolecular weight:341.407




