CAS 14307-17-6
:2-amino-2-deoxygalacturonic acid
Description:
2-Amino-2-deoxygalacturonic acid is an amino sugar and a derivative of galacturonic acid, characterized by the presence of an amino group at the second carbon position and a hydroxyl group at the fourth carbon. This compound is typically found in the structure of pectin, a polysaccharide present in plant cell walls, contributing to the rigidity and stability of plant tissues. It is a white to off-white crystalline solid that is soluble in water, reflecting its polar nature due to the presence of hydroxyl and amino functional groups. The compound plays a role in various biological processes, including cell signaling and structural integrity in plants. Its chemical properties include the ability to participate in hydrogen bonding, which enhances its solubility and reactivity. Additionally, 2-amino-2-deoxygalacturonic acid can undergo various chemical reactions typical of amino sugars, such as acylation and oxidation, making it a valuable compound in biochemical research and potential applications in pharmaceuticals and food science.
Formula:C6H11NO6
InChI:InChI=1/C6H11NO6/c7-2(1-8)3(9)4(10)5(11)6(12)13/h1-5,9-11H,7H2,(H,12,13)/t2-,3+,4+,5-/m0/s1
Synonyms:- 2-Amino-2-deoxy-L-galacturonic acid
- Aminogalacturnoic acid
- D-Galacturonic acid, 2-amino-2-deoxy-
- 2-amino-2-deoxy-D-galacturonic acid
- 2-Amino-2-deoxygalacturonic acid
- 2-Amino-2-deoxy-D-Galactronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
D-Aminogalacturonic Acid Hydrochloride
CAS:Controlled ProductApplications 2-Amino-2-deoxygalacturonic acid was a component of the lipopolysaccharide from P. aeruginosa NCTC 8505 and probably occurs in the region of polysaccharide responsible for O-antigenic specificity.
References Wilkinson, S.G., et al.: Biochem. J., 149, 783 (1975),Formula:C6H12ClNO6Color and Shape:NeatMolecular weight:229.62
