CAS 14307-89-2
:N,N-dimethyl-N~2~-phenylglycinamide
Description:
N,N-Dimethyl-N^2-phenylglycinamide, identified by its CAS number 14307-89-2, is an organic compound characterized by its amide functional group, which is derived from phenylglycine. This substance features a dimethyl substitution on the nitrogen atom, contributing to its unique chemical properties. It typically appears as a solid or crystalline material and is soluble in polar solvents due to the presence of the amide group. The compound is of interest in various fields, including medicinal chemistry, where it may exhibit biological activity or serve as an intermediate in the synthesis of pharmaceuticals. Its structure allows for potential interactions with biological targets, making it a candidate for further research in drug development. Additionally, the presence of both a phenyl group and a glycine derivative suggests that it may participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and stability. As with many organic compounds, handling should be done with care, considering safety protocols to mitigate any potential hazards.
Formula:C10H14N2O
InChI:InChI=1/C10H14N2O/c1-12(2)10(13)8-11-9-6-4-3-5-7-9/h3-7,11H,8H2,1-2H3
SMILES:CN(C)C(=O)CNc1ccccc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N,N-Dimethyl-2-(phenylamino)acetamide
CAS:In the late 1990s, a new chemical compound was discovered with a novel inhibitory effect on tumor growth. This compound is called N,N-dimethyl-2-(phenylamino)acetamide (DPA). DPA has been shown to inhibit tumor growth by preventing the synthesis of glucose. It also inhibits tumor growth in vivo and in vitro. DPA has been found to be effective against cancer cells that are resistant to chemotherapy and radiation therapy. The mechanism of action is not yet known, but it may be related to its ability to bind to sugar molecules or its inhibition of glucose production by pancreatic beta cells.
The structural analysis of this compound is still being studied, but it is thought that it may be derived from either wheat germ or monoclonal antibodies.Formula:C10H14N2OPurity:Min. 95%Molecular weight:178.23 g/mol
