
CAS 143074-72-0
:3-(3-Fluorophenyl)-2(1H)-pyridinone
Description:
3-(3-Fluorophenyl)-2(1H)-pyridinone, identified by its CAS number 143074-72-0, is an organic compound characterized by a pyridinone core substituted with a 3-fluorophenyl group. This compound typically exhibits a pale to light-colored solid form and is soluble in organic solvents, reflecting its aromatic nature. The presence of the fluorine atom enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The pyridinone moiety contributes to its potential as a chelating agent or in coordination chemistry. Additionally, the compound may exhibit various functional properties, including potential antimicrobial or anti-inflammatory activities, depending on its specific interactions within biological systems. Its synthesis often involves multi-step organic reactions, and it may serve as a precursor or intermediate in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles.
Formula:C11H8FNO
InChI:InChI=1S/C11H8FNO/c12-9-4-1-3-8(7-9)10-5-2-6-13-11(10)14/h1-7H,(H,13,14)
InChI key:InChIKey=GHFKISKLUPGKHF-UHFFFAOYSA-N
SMILES:O=C1C(C2=CC(F)=CC=C2)=CC=CN1
Synonyms:- 2(1H)-Pyridinone, 3-(3-fluorophenyl)-
- 3-(3-Fluorophenyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.