CymitQuimica logo

CAS 143086-29-7

:

methyl 3-[2-(dimethylamino)-2-oxoethyl]-2-(4-methylphenyl)imidazo[1,2-a]pyridine-6-carboxylate

Description:
Methyl 3-[2-(dimethylamino)-2-oxoethyl]-2-(4-methylphenyl)imidazo[1,2-a]pyridine-6-carboxylate, identified by its CAS number 143086-29-7, is a synthetic organic compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core. This compound features a carboxylate ester functional group, contributing to its potential reactivity and solubility properties. The presence of a dimethylamino group suggests it may exhibit basic characteristics, while the 4-methylphenyl substituent can influence its lipophilicity and biological activity. The compound's structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the imidazole ring's known biological significance. Additionally, the presence of the oxoethyl group may enhance its reactivity in various chemical transformations. Overall, this compound's unique structural features may confer specific pharmacological properties, making it a subject of interest in drug discovery and development.
Formula:C20H21N3O3
InChI:InChI=1/C20H21N3O3/c1-13-5-7-14(8-6-13)19-16(11-18(24)22(2)3)23-12-15(20(25)26-4)9-10-17(23)21-19/h5-10,12H,11H2,1-4H3
SMILES:Cc1ccc(cc1)c1c(CC(=O)N(C)C)n2cc(ccc2n1)C(=O)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.