CAS 143122-18-3

(2-mercapto-1-methyl-1H-imidazol-5-yl)methanol

Description:

(2-Mercapto-1-methyl-1H-imidazol-5-yl)methanol is a chemical compound characterized by the presence of a mercapto group (-SH) and an imidazole ring, which contributes to its potential biological activity. The imidazole moiety is known for its role in various biochemical processes, including enzyme catalysis and as a building block in many pharmaceuticals. The compound features a hydroxymethyl group (-CH2OH) that can participate in hydrogen bonding, enhancing its solubility in polar solvents. Its mercapto group may impart reducing properties, making it useful in redox reactions and as a potential antioxidant. The presence of the methyl group on the imidazole ring can influence the compound's steric and electronic properties, affecting its reactivity and interaction with biological targets. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. However, specific applications and biological activities would require further investigation through experimental studies.

Formula: C₅H₈N₂OS

InChI: InChI=1/C5H8N2OS/c1-7-4(3-8)2-6-5(7)9/h2,8H,3H2,1H3,(H,6,9)

SMILES: Cn1c(cnc1S)CO

Synonyms:

• 5-(hydroxymethyl)-1-methyl-1,3-dihydro-2H-imidazole-2-thione

2H-Imidazole-2-thione,1,3-dihydro-5-(hydroxymethyl)-1-methyl-

CAS: 143122-18-3

Formula: C₅H₈N₂OS

Purity: 97%

Color and Shape: Solid

Molecular weight: 144.1948

Ref: IN-DA007Z42

(2-mercapto-1-methyl-1H-imidazol-5-yl)methanol

CAS: 143122-18-3

(2-mercapto-1-methyl-1H-imidazol-5-yl)methanol

Purity: 95%

Molecular weight: 144.19482g/mol

Ref: 54-OR30254

(2-Mercapto-1-methyl-1H-imidazol-5-yl)methanol

CAS: 143122-18-3

Formula: C₅H₈N₂OS

Purity: 97%

Color and Shape: Solid

Molecular weight: 144.19

Ref: 10-F403141

5-Hydroxymethyl-2-mercapto-1-methyl-1H-imidazole

CAS: 143122-18-3

5-Hydroxymethyl-2-mercapto-1-methyl-1H-imidazole is an elemental compound that has potential antimicrobial activity. Elemental analysis of this compound showed a molecular weight of 121.085 g/mol and a melting point of 182.6 °C. Spectroscopy and mass spectroscopy confirmed the molecular formula C5H9N3S with one hydroxyl group, two methyl groups, and one sulfur atom. This compound also has antimicrobial properties, which may be due to its ability to inhibit bacterial growth through binding to DNA or by inhibiting protein synthesis.

Formula: C₅H₈N₂OS

Purity: Min. 95%

Molecular weight: 144.19 g/mol

Ref: 3D-TFA12218