CAS 143129-01-5
:vitalethine
Description:
Vitalethine, with the CAS number 143129-01-5, is a chemical compound that has garnered interest primarily for its potential biological activities. It is classified as a natural product and is derived from certain plant sources. Vitalethine is known for its structural complexity, which includes multiple functional groups that contribute to its reactivity and interaction with biological systems. The compound has been studied for its potential antioxidant properties, which may play a role in mitigating oxidative stress in cells. Additionally, vitalethine has been investigated for its possible effects on cellular signaling pathways, suggesting a role in various physiological processes. Its solubility characteristics and stability under different conditions are also important for its application in research and potential therapeutic uses. However, further studies are necessary to fully elucidate its mechanisms of action and potential health benefits. As with many natural compounds, the exploration of vitalethine's properties continues to evolve, highlighting the importance of ongoing research in the field of natural product chemistry.
Formula:C12H22N4O6S2
InChI:InChI=1/C12H22N4O6S2/c17-9(1-3-15-11(19)20)13-5-7-23-24-8-6-14-10(18)2-4-16-12(21)22/h15-16H,1-8H2,(H,13,17)(H,14,18)(H,19,20)(H,21,22)
SMILES:C(CNC(=O)O)C(=NCCSSCCN=C(CCNC(=O)O)O)O
Synonyms:- 3,3'-(Dithiodi-2,1-ethanediylamino)bis(N-(3-oxopropyl)carbamic acid)
- Thiol N-(carboxy)-beta-alanylcysteamine
- 9,10-Dithia-2,6,13,17-tetraazaoctadecanedioic acid, 5,14-dioxo-
- (16-Hydroxy-3,12,16-Trioxo-7,8-Dithia-4,11,15-Triazahexadec-1-Yl)Carbamic Acid (Non-Preferred Name)
- Vitalethine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Vitalethine-d8
CAS:Controlled ProductFormula:C12D8H14N4O6S2Color and Shape:NeatMolecular weight:390.506Vitalethine
CAS:Vitalethine is a protein analog that has been shown to induce apoptosis in cancer cells. It acts as a kinase inhibitor and specifically targets the hepcidin pathway, which is involved in tumor growth and metastasis. Vitalethine has been tested on human cancer cell lines and has shown potent anticancer activity. This protein analog may have potential therapeutic applications for the treatment of various types of cancers. Vitalethine can be detected in urine samples and may serve as a biomarker for cancer diagnosis and monitoring.
Formula:C12H22N4O6S2Purity:Min. 95%Molecular weight:382.5 g/mol

