CAS 1431329-71-3

(OC-6-21)-[3-(Aminocarbonyl)-4-chlorophenyl]pentafluorosulfur

Description:

(OC-6-21)-[3-(Aminocarbonyl)-4-chlorophenyl]pentafluorosulfur is a chemical compound characterized by its unique structure, which includes a pentafluorosulfur moiety and an aminocarbonyl group attached to a chlorophenyl ring. The presence of multiple fluorine atoms contributes to its high electronegativity and potential reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The chlorophenyl group may enhance its biological activity and lipophilicity, while the aminocarbonyl functionality can participate in hydrogen bonding and other interactions, influencing its solubility and stability. This compound may exhibit specific properties such as high thermal stability and resistance to degradation, which are typical of fluorinated compounds. Its synthesis and handling require careful consideration due to the potential toxicity associated with fluorinated species and the chlorinated aromatic system. Overall, (OC-6-21)-[3-(Aminocarbonyl)-4-chlorophenyl]pentafluorosulfur represents a complex chemical entity with potential utility in advanced material science and medicinal chemistry.

Formula: C₇H₅ClF₅NOS

InChI: InChI=1S/C7H5ClF5NOS/c8-6-2-1-4(3-5(6)7(14)15)16(9,10,11,12)13/h1-3H,(H2,14,15)

InChI key: InChIKey=ISPQOXNUNOTXHB-UHFFFAOYSA-N

SMILES: S(F)(F)(F)(F)(F)C1=CC(C(N)=O)=C(Cl)C=C1

Synonyms:

• Sulfur, [3-(aminocarbonyl)-4-chlorophenyl]pentafluoro-, (OC-6-21)-
• (OC-6-21)-[3-(Aminocarbonyl)-4-chlorophenyl]pentafluorosulfur

2-Chloro-5-(pentafluorosulfur)benzamide

CAS: 1431329-71-3

2-Chloro-5-(pentafluorosulfur)benzamide

Formula: C₇H₅ClF₅NOS

Purity: 98%

Color and Shape: white powder

Molecular weight: 281.63g/mol

Ref: 54-PC302794