
CAS 1431373-77-1
:2,3-Dihydro-1-(3-hydroxypropyl)-5-[(2R)-2-[[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl]amino]propyl]-1H-indole-7-carboxylic acid
Description:
2,3-Dihydro-1-(3-hydroxypropyl)-5-[(2R)-2-[[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl]amino]propyl]-1H-indole-7-carboxylic acid, identified by its CAS number 1431373-77-1, is a complex organic compound characterized by its multi-functional structure. It features an indole core, which is a bicyclic structure known for its presence in many biologically active compounds. The presence of a carboxylic acid group indicates potential acidic properties, while the hydroxypropyl and trifluoroethoxy substituents suggest hydrophilicity and lipophilicity, respectively, which can influence its solubility and biological activity. The compound's design may imply potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its intricate structure, including multiple functional groups, suggests that it may interact with various biological targets, making it a candidate for further investigation in drug development. However, detailed studies would be necessary to elucidate its specific properties, mechanisms of action, and potential therapeutic uses.
Formula:C25H31F3N2O5
InChI:InChI=1S/C25H31F3N2O5/c1-17(29-8-12-34-21-5-2-3-6-22(21)35-16-25(26,27)28)13-18-14-19-7-10-30(9-4-11-31)23(19)20(15-18)24(32)33/h2-3,5-6,14-15,17,29,31H,4,7-13,16H2,1H3,(H,32,33)/t17-/m1/s1
InChI key:InChIKey=WRAJSSUVHACADP-QGZVFWFLSA-N
SMILES:C(CCO)N1C=2C(=CC(C[C@H](NCCOC3=C(OCC(F)(F)F)C=CC=C3)C)=CC2C(O)=O)CC1
Synonyms:- 2,3-Dihydro-1-(3-hydroxypropyl)-5-[(2R)-2-[[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl]amino]propyl]-1H-indole-7-carboxylic acid
- 1H-Indole-7-carboxylic acid, 2,3-dihydro-1-(3-hydroxypropyl)-5-[(2R)-2-[[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl]amino]propyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

