CymitQuimica logo

CAS 143141-23-5

:

1H-Pyrrolo[2,3-b]pyridine, 1-(phenylsulfonyl)-

Description:
1H-Pyrrolo[2,3-b]pyridine, 1-(phenylsulfonyl)-, identified by CAS number 143141-23-5, is a heterocyclic organic compound characterized by a fused pyrrole and pyridine structure, which contributes to its unique chemical properties. This compound features a phenylsulfonyl group, enhancing its reactivity and potential applications in medicinal chemistry. The presence of the sulfonyl moiety often increases solubility and can influence the compound's biological activity. Typically, compounds of this class exhibit interesting pharmacological properties, making them candidates for drug development. The molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can be crucial in biological systems. Additionally, the compound's stability and reactivity can be influenced by substituents on the aromatic ring and the nitrogen atoms in the heterocyclic framework. Overall, 1H-Pyrrolo[2,3-b]pyridine, 1-(phenylsulfonyl)- is of interest in research for its potential therapeutic applications and as a building block in organic synthesis.
Formula:C13H10N2O2S
InChI:InChI=1S/C13H10N2O2S/c16-18(17,12-6-2-1-3-7-12)15-10-8-11-5-4-9-14-13(11)15/h1-10H
InChI key:KEPQQULYWDIKEK-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2N=CC=C3
Synonyms:
  • 1-(Phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
  • 1-(benzenesulfonyl)-1H-pyrrolo[2,3-b]pyridine
Found 3 products.