CAS 1431412-19-9

4-Methoxyfuro[3,2-d]pyrimidine-6-carboxylic acid

Description:

4-Methoxyfuro[3,2-d]pyrimidine-6-carboxylic acid is a heterocyclic organic compound characterized by its unique fused ring structure, which includes a furan and pyrimidine moiety. This compound features a methoxy group (-OCH3) at the 4-position of the furo ring and a carboxylic acid group (-COOH) at the 6-position of the pyrimidine ring, contributing to its potential reactivity and solubility properties. The presence of these functional groups suggests that it may exhibit acidic behavior and could participate in various chemical reactions, such as esterification or amidation. Its molecular structure may also influence its biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the compound's solubility in polar solvents may facilitate its use in various applications, including pharmaceuticals and agrochemicals. Overall, 4-Methoxyfuro[3,2-d]pyrimidine-6-carboxylic acid represents a versatile scaffold for further chemical modifications and investigations.

Formula: C₈H₆N₂O₄

InChI: InChI=1S/C8H6N2O4/c1-13-7-6-4(9-3-10-7)2-5(14-6)8(11)12/h2-3H,1H3,(H,11,12)

InChI key: InChIKey=BFINEDABYOVUMR-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(C=C(C(O)=O)O2)=NC=N1

Synonyms:

• Furo[3,2-d]pyrimidine-6-carboxylic acid, 4-methoxy-
• 4-Methoxyfuro[3,2-d]pyrimidine-6-carboxylic acid

4-Methoxyfuro[3,2-d]pyrimidine-6-carboxylic acid

CAS: 1431412-19-9

Formula: C₈H₆N₂O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 194.1442

Ref: IN-DA00A14R

4-Methoxyfuro[3,2-d]pyrimidine-6-carboxylic acid

CAS: 1431412-19-9

4-Methoxyfuro[3,2-d]pyrimidine-6-carboxylic acid

Purity: 97%

Molecular weight: 194.14g/mol

Ref: 54-OR83230

4-Methoxyfuro[3,2-d]pyrimidine-6-carboxylic acid

CAS: 1431412-19-9

Formula: C₈H₆N₂O₄

Purity: 97%

Molecular weight: 194.146

Ref: 10-F499061