CAS 14315-15-2
:7-METHYL-BENZO[B]THIOPHENE
Description:
7-Methyl-benzothiophene is an organic compound characterized by its fused ring structure, which consists of a benzene ring and a thiophene ring, with a methyl group attached at the 7-position of the benzothiophene framework. This compound is part of the larger class of polycyclic aromatic hydrocarbons (PAHs) and is known for its aromatic properties, which contribute to its stability and potential reactivity. It typically exhibits a non-polar nature, making it soluble in organic solvents but insoluble in water. The presence of the sulfur atom in the thiophene ring can influence its electronic properties and reactivity, potentially allowing for interactions with various biological systems. 7-Methyl-benzothiophene may be of interest in fields such as organic synthesis, materials science, and environmental chemistry, particularly in studies related to the behavior of PAHs in the environment and their implications for human health. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C9H8S
InChI:InChI=1/C9H8S/c1-7-3-2-4-8-5-6-10-9(7)8/h2-6H,1H3
SMILES:Cc1cccc2ccsc12
Synonyms:- 7-Methylbenzothiophene
- 7-Methyl-1-Benzothiophene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-methyl-1-benzothiophene
CAS:7-methyl-1-benzothiophene is an enthalpic, programmed, linear regression analysis, aldehydes, desulfurization, stable compounds, molecular orbitals. 7-Methyl-1-benzothiophene is involved in the synthesis of antiinflammatory drugs and antioxidants. It has been shown to be effective for the treatment of chronic inflammatory diseases such as arthritis and asthma. 7-Methyl-1-benzothiophene also possesses antioxidant properties that may be useful in preventing cancer or heart disease. The stability of this compound makes it suitable for use in different chromatographic methods or as a precursor for other chemical reactions. This substance also has been shown to be necessary for the production of some proteins related to cell growth.Formula:C9H8SPurity:Min. 95%Molecular weight:148.22 g/mol



