CAS 1431510-26-7

6-Bromo-4-[(4-methyl-3-nitrophenyl)amino]-3-quinolinecarboxaldehyde

Description:

6-Bromo-4-[(4-methyl-3-nitrophenyl)amino]-3-quinolinecarboxaldehyde is a synthetic organic compound characterized by its complex molecular structure, which includes a quinoline core, a bromine substituent, and an aldehyde functional group. This compound features a nitrophenyl moiety that contributes to its potential biological activity. The presence of the bromine atom enhances its reactivity and may influence its pharmacological properties. The nitro group is known for its electron-withdrawing effects, which can affect the compound's electronic properties and reactivity. Additionally, the aldehyde group can participate in various chemical reactions, such as condensation and reduction, making it versatile in synthetic applications. This compound may exhibit interesting biological activities, including potential antimicrobial or anticancer properties, although specific biological data would require further investigation. Its unique structure and functional groups make it a candidate for research in medicinal chemistry and related fields. As with any chemical substance, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₇H₁₂BrN₃O₃

InChI: InChI=1S/C17H12BrN3O3/c1-10-2-4-13(7-16(10)21(23)24)20-17-11(9-22)8-19-15-5-3-12(18)6-14(15)17/h2-9H,1H3,(H,19,20)

InChI key: InChIKey=JXNDRJOKVJEQMU-UHFFFAOYSA-N

SMILES: N(C=1C2=C(N=CC1C=O)C=CC(Br)=C2)C3=CC(N(=O)=O)=C(C)C=C3

Synonyms:

• 3-Quinolinecarboxaldehyde, 6-bromo-4-[(4-methyl-3-nitrophenyl)amino]-
• 6-Bromo-4-((4-methyl-3-nitrophenyl)amino)quinoline-3-carbaldehyde
• 6-Bromo-4-[(4-methyl-3-nitrophenyl)amino]-3-quinolinecarboxaldehyde