CAS 143162-65-6
:SPR 210
Description:
SPR 210, with the CAS number 143162-65-6, is a chemical compound that is primarily recognized for its application in the field of pharmaceuticals and biochemistry. It is characterized by its specific molecular structure, which contributes to its unique properties and reactivity. SPR 210 is often utilized as a research tool or a potential therapeutic agent, particularly in studies related to enzyme inhibition or receptor modulation. The compound may exhibit specific solubility characteristics, stability under various conditions, and a defined mechanism of action, making it valuable in experimental settings. Additionally, safety data sheets and regulatory information should be consulted to understand its handling, storage, and potential hazards. As with many chemical substances, its behavior can be influenced by environmental factors such as pH, temperature, and the presence of other chemicals. Overall, SPR 210 represents a significant compound within its category, warranting further investigation for its potential applications in scientific research and medicine.
Formula:C18H11F3N2O3S2
InChI:InChI=1/C18H11F3N2O3S2/c1-7-3-2-4-10-15(7)23(17(26)11(27-10)6-12(24)25)18-22-14-13(21)8(19)5-9(20)16(14)28-18/h2-5,11H,6H2,1H3,(H,24,25)
SMILES:Cc1cccc2c1N(C(=O)C(CC(=O)O)S2)c1nc2c(c(cc(c2s1)F)F)F
Synonyms:- 2-(4-(4,5,7-Trifluorobenzothiazol-2-yl)methyl-3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl)acetic acid
- 3,4-Dihydro-3-oxo-4-((4,5,7-trifluoro-2-benzothiazolyl)methyl)-2H-1,4-benzothiazine-2-acetic acid
- 3,4-Dihydro-3-oxo-4-((4,5,7-trifuruoro-2-benzothiazolyl)methyl)-2H-1,4-benzothiazine-2-acetic acid
- Sg-210
- 2H-1,4-Benzothiazine-2-acetic acid, 3,4-dihydro-3-oxo-4-((4,5,7-trifuruoro-2-benzothiazolyl)methyl)-
- [5-methyl-3-oxo-4-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)-3,4-dihydro-2H-1,4-benzothiazin-2-yl]acetic acid
- Spr-210
- Spr 210
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Spr 210
CAS:Spr 210 is an aldose reductase (AR) inhibitor with potential uses as a therapeutic agent for preventing and improving some diabetic complications.Formula:C18H11F3N2O3S2Color and Shape:SolidMolecular weight:424.42
