CAS 14317-68-1
:DEAMINO-DICARBA-OXYTOCIN
Description:
Deamino-Dicarba-Oxytocin is a synthetic analog of the naturally occurring hormone oxytocin, which plays a crucial role in various physiological processes, including childbirth and lactation. This compound is characterized by modifications to its peptide structure, specifically the removal of the amino group and the incorporation of a dicarba framework, which enhances its stability and resistance to enzymatic degradation. As a result, Deamino-Dicarba-Oxytocin exhibits prolonged activity compared to its natural counterpart. It primarily interacts with oxytocin receptors, influencing social behaviors, reproductive functions, and emotional bonding. The compound is of interest in pharmacological research for its potential therapeutic applications, including the treatment of social anxiety disorders and enhancing maternal behaviors. Additionally, its unique structural features make it a valuable tool for studying the mechanisms of oxytocin action in various biological systems. Overall, Deamino-Dicarba-Oxytocin represents a significant advancement in peptide chemistry, offering insights into hormone function and potential clinical applications.
Formula:C45H69N11O12
InChI:InChI=1/C45H69N11O12/c1-5-25(4)38-44(67)51-28(17-18-34(46)58)40(63)53-32(22-35(47)59)41(64)52-29(10-7-6-8-12-37(61)50-31(42(65)55-38)21-26-13-15-27(57)16-14-26)45(68)56-19-9-11-33(56)43(66)54-30(20-24(2)3)39(62)49-23-36(48)60/h13-16,24-25,28-33,38,57H,5-12,17-23H2,1-4H3,(H2,46,58)(H2,47,59)(H2,48,60)(H,49,62)(H,50,61)(H,51,67)(H,52,64)(H,53,63)(H,54,66)(H,55,65)/t25-,28-,29-,30-,31-,32-,33-,38-/m0/s1
Synonyms:- 1-({(2S,5S,8S,11S,14S)-11-(2-amino-2-oxoethyl)-8-(3-amino-3-oxopropyl)-2-(4-hydroxybenzyl)-5-[(1S)-1-methylpropyl]-3,6,9,12,20-pentaoxo-1,4,7,10,13-pentaazacycloicosan-14-yl}carbonyl)-L-prolyl-L-leucylglycinamide
- oxytocin, 1,6-alpha-Asu-
- [ASU 1,6] OT
- CYCLO(TYR-ILE-GLN-ASN-ASU)-PRO-LEU-GLY-NH2
- [ASU 1,6] OXYTOCIN
- TYR-ILE-GLN-ASN-ASU-PRO-LEU-GLY-NH2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
[Asu1,6]-Oxytocin
CAS:Oxytocin is a peptide hormone and neurotransmitter. It is primarily used in the brain to regulate social behavior, such as maternal behaviour, sexual arousal and romantic attachment. Oxytocin is also used for uterine contractions during childbirth and to induce labour. Oxytocin can be administered by injection or as nasal spray. It has a half-life of about two minutes in the blood stream and its effects last up to one hour. Oxytocin is a nonapeptide with the amino acid sequence: Cys-Tyr-Ile-Gln-Asn-Cys-Pro-Arg-Gly-Leu-Met-(OH). The oxytocin receptor (OXTR) belongs to G protein coupled receptors (GPCR), which are known for their roles in cell signaling, oncogenesis, immunity, inflammation, pain sensation and endocrine regulation. The OXTR is expressed throughout the body including the uterus and vagina.Formula:C45H69N11O12Purity:Min. 95%Molecular weight:956.1 g/mol
