
CAS 1431727-00-2
:2-Methyl-N-[2-[[3-[(1-oxo-2-propen-1-yl)amino]phenyl]amino]-5-pyrimidinyl]-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide
Description:
The chemical substance known as 2-Methyl-N-[2-[[3-[(1-oxo-2-propen-1-yl)amino]phenyl]amino]-5-pyrimidinyl]-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide], with the CAS number 1431727-00-2, is a complex organic compound characterized by its multi-functional structure. It features a pyrimidine ring, which is a six-membered aromatic heterocycle containing nitrogen atoms, and multiple aromatic amine groups that contribute to its potential biological activity. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its pharmacokinetic properties. Additionally, the compound contains an α,β-unsaturated carbonyl moiety, which can participate in various chemical reactions, including Michael addition and nucleophilic attack. This compound is likely to exhibit significant interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its intricate structure suggests potential applications in therapeutic areas, although specific biological activities and mechanisms would require further investigation through experimental studies.
Formula:C29H23F3N6O3
InChI:InChI=1S/C29H23F3N6O3/c1-3-25(39)35-20-8-5-9-21(13-20)38-28-33-15-23(16-34-28)37-27(41)24-14-22(11-10-17(24)2)36-26(40)18-6-4-7-19(12-18)29(30,31)32/h3-16H,1H2,2H3,(H,35,39)(H,36,40)(H,37,41)(H,33,34,38)
InChI key:InChIKey=BTWVWABAWDKQNJ-UHFFFAOYSA-N
SMILES:N(C1=CC(NC(C=C)=O)=CC=C1)C=2N=CC(NC(=O)C3=CC(NC(=O)C4=CC(C(F)(F)F)=CC=C4)=CC=C3C)=CN2
Synonyms:- PLS 058
- 2-Methyl-N-[2-[[3-[(1-oxo-2-propen-1-yl)amino]phenyl]amino]-5-pyrimidinyl]-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide
- Benzamide, 2-methyl-N-[2-[[3-[(1-oxo-2-propen-1-yl)amino]phenyl]amino]-5-pyrimidinyl]-5-[[3-(trifluoromethyl)benzoyl]amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
BLK-IN-1
CAS:BLK-IN-1 selectively blocks BLK and BTK with IC50s of 18.8 and 20.5 nM, used in cancer research.Formula:C29H23F3N6O3Color and Shape:SolidMolecular weight:560.53
