CymitQuimica logo

CAS 143174-02-1

:

Benzonitrile, 3-amino-4-(ethylamino)- (9CI)

Description:
Benzonitrile, 3-amino-4-(ethylamino)-, also known by its CAS number 143174-02-1, is an organic compound characterized by the presence of both an amino group and an ethylamino group attached to a benzonitrile structure. This compound features a benzene ring substituted with a nitrile group (–C≡N) and two amino functional groups, which contribute to its reactivity and potential applications in various chemical processes. The presence of the amino groups enhances its solubility in polar solvents and may facilitate interactions with biological systems, making it of interest in pharmaceutical research. Additionally, the compound's structure suggests potential for hydrogen bonding and other intermolecular interactions, which can influence its physical properties such as melting point, boiling point, and solubility. As with many organic compounds, safety considerations should be taken into account when handling this substance, including proper storage and disposal methods to mitigate any environmental or health risks.
Formula:C9H11N3
InChI:InChI=1S/C9H11N3/c1-2-12-9-4-3-7(6-10)5-8(9)11/h3-5,12H,2,11H2,1H3
InChI key:WHLUSMYQBHWGSV-UHFFFAOYSA-N
SMILES:CCNC1=C(C=C(C=C1)C#N)N
Found 4 products.