CAS 143185-43-7

2-(2-N-BOC-AMINOETHYL) PYRIDINE

Description:

2-(2-N-BOC-Aminoethyl) pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the N-Boc (tert-butyloxycarbonyl) protecting group on the aminoethyl side chain enhances its stability and solubility, making it useful in various synthetic applications, particularly in peptide synthesis and medicinal chemistry. This compound typically exhibits moderate polarity due to the combination of the hydrophobic pyridine ring and the hydrophilic amino group. It is generally soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, while being less soluble in water. The N-Boc group can be removed under acidic conditions, allowing for the release of the free amine, which can participate in further chemical reactions. Additionally, 2-(2-N-BOC-aminoethyl) pyridine may exhibit biological activity, making it a candidate for drug development and research in pharmacology. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₂H₁₈N₂O₂

InChI: InChI=1/C12H18N2O2/c1-12(2,3)16-11(15)14-9-7-10-6-4-5-8-13-10/h4-6,8H,7,9H2,1-3H3,(H,14,15)

SMILES: CC(C)(C)OC(=NCCc1ccccn1)O

Synonyms:

• carbamic acid, N-[2-(2-pyridinyl)ethyl]-, 1,1-dimethylethyl ester
• tert-Butyl [2-(pyridin-2-yl)ethyl]carbamate

tert-Butyl 2-pyridin-2-ylethylcarbamate

CAS: 143185-43-7

tert-Butyl 2-pyridin-2-ylethylcarbamate

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 222.28g/mol

Ref: 54-OR200128