CAS 143188-53-8
:4-amino-1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one; phosphoric acid
Description:
4-amino-1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one, commonly known as a nucleotide analog, is characterized by its structural features that include a pyrimidine ring and an oxathiolane moiety. This compound exhibits properties typical of nucleoside analogs, which can interfere with nucleic acid synthesis and function. The presence of the amino group enhances its potential for hydrogen bonding, contributing to its biological activity. The hydroxymethyl group on the oxathiolane ring is significant for its interaction with biological targets, potentially influencing its pharmacokinetics and efficacy. Additionally, the compound is often associated with phosphoric acid, which can enhance solubility and stability in aqueous environments. This substance is of interest in medicinal chemistry, particularly in the development of antiviral and anticancer agents, due to its ability to mimic natural nucleotides. Its specific stereochemistry, particularly the (2S,5R) configuration, is crucial for its biological activity and interaction with enzymes involved in nucleic acid metabolism.
Formula:C8H20N3O15P3S
InChI:InChI=1/C8H11N3O3S.3H3O4P/c9-5-1-2-11(8(13)10-5)6-4-15-7(3-12)14-6;3*1-5(2,3)4/h1-2,6-7,12H,3-4H2,(H2,9,10,13);3*(H3,1,2,3,4)/t6-,7+;;;/m1.../s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Lamivudine Triphosphate Triethylamine Salt (90%)
CAS:Controlled ProductStability Hygroscopic
Applications A metabolite of Lamivudine (L172500).
References Burgess, K., et al.: Chem. Rev., 100, 2047 (2000), Gallois-Montbrun, S., et al.: Biochem. Pharmacol., 68, 1749 (2004),Formula:C8H14N3O12P3SC6H15NxPurity:90%Color and Shape:NeatMolecular weight:469.2010119Lamivudine Triphosphate-15N2,13C Triethylamine Salt (90%)
CAS:Controlled ProductFormula:C7CH14NN2O12P3SC6H15NPurity:90%Color and Shape:NeatMolecular weight:570.07155
