CAS 1431962-19-4

Ethanone, 1-[4-methyl-2-(2-propen-1-ylamino)-5-thiazolyl]-, hydrochloride (1:1)

Description:

Ethanone, 1-[4-methyl-2-(2-propen-1-ylamino)-5-thiazolyl]-, hydrochloride (1:1), identified by CAS number 1431962-19-4, is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity. The presence of the ethanone moiety indicates that it is a ketone, which typically exhibits reactivity due to the carbonyl group. The compound features a substituted thiazole ring, which is known for its role in various pharmacological activities, including antimicrobial and anticancer properties. The hydrochloride form suggests that it is a salt, enhancing its solubility in water and potentially improving its bioavailability. This compound may be of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications. As with many organic compounds, its stability, reactivity, and interactions with biological systems would be influenced by its functional groups and overall molecular structure. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₉H₁₂N₂OS·ClH

InChI: InChI=1S/C9H12N2OS.ClH/c1-4-5-10-9-11-6(2)8(13-9)7(3)12;/h4H,1,5H2,2-3H3,(H,10,11);1H

InChI key: InChIKey=BHUHDZDKAOMKKE-UHFFFAOYSA-N

SMILES: C(C)(=O)C=1SC(NCC=C)=NC1C.Cl

Synonyms:

• Ethanone, 1-[4-methyl-2-(2-propen-1-ylamino)-5-thiazolyl]-, hydrochloride (1:1)

1-{4-Methyl-2-[(prop-2-en-1-yl)amino]-1,3-thiazol-5-yl}ethan-1-one hydrochloride

CAS: 1431962-19-4

Versatile small molecule scaffold

Formula: C₉H₁₃ClN₂OS

Purity: Min. 95%

Molecular weight: 232.73 g/mol

Ref: 3D-GHC96219